C15H16N2O2S2 — CID 38710126
2-(2-amino-2-oxoethyl)sulfanyl-N-methyl-N-(thiophen-3-ylmethyl)benzamide (PubChem CID 38710126) has the molecular formula C15H16N2O2S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-(2-amino-2-oxoethyl)sulfanyl-N-methyl-N-(thiophen-3-ylmethyl)benzamide.
| Compound Name | 2-(2-amino-2-oxoethyl)sulfanyl-N-methyl-N-(thiophen-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 38710126 |
| Molecular Formula | C15H16N2O2S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 2-(2-amino-2-oxoethyl)sulfanyl-N-methyl-N-(thiophen-3-ylmethyl)benzamide |
| SMILES | CN(Cc1ccsc1)C(=O)c1ccccc1SCC(N)=O |
| InChI | InChI=1S/C15H16N2O2S2/c1-17(8-11-6-7-20-9-11)15(19)12-4-2-3-5-13(12)21-10-14(16)18/h2-7,9H,8,10H2,1H3,(H2,16,18) |
| InChIKey | PZJPUUIVMXGYNH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |