C30H27N3O6 — CID 3871244
3-(carboxymethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-5-(2-pyridin-2-ylethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3871244) has the molecular formula C30H27N3O6 and a molecular weight of 525.56 g/mol. Its IUPAC name is 3-(carboxymethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-5-(2-pyridin-2-ylethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-(carboxymethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-5-(2-pyridin-2-ylethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3871244 |
| Molecular Formula | C30H27N3O6 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 3-(carboxymethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-5-(2-pyridin-2-ylethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C(O)CC1(C(=O)O)NC(c2ccc(C=Cc3ccccc3)cc2)C2C(=O)N(CCc3ccccn3)C(=O)C21 |
| InChI | InChI=1S/C30H27N3O6/c34-23(35)18-30(29(38)39)25-24(27(36)33(28(25)37)17-15-22-8-4-5-16-31-22)26(32-30)21-13-11-20(12-14-21)10-9-19-6-2-1-3-7-19/h1-14,16,24-26,32H,15,17-18H2,(H,34,35)(H,38,39) |
| InChIKey | SQTMQONUVJREBY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 136.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|