C16H19N3O6S2 — CID 3871665
3-(carboxymethyl)-5-(3-methylsulfanylpropyl)-4,6-dioxo-1-(1,3-thiazol-2-yl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3871665) has the molecular formula C16H19N3O6S2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 3-(carboxymethyl)-5-(3-methylsulfanylpropyl)-4,6-dioxo-1-(1,3-thiazol-2-yl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-(carboxymethyl)-5-(3-methylsulfanylpropyl)-4,6-dioxo-1-(1,3-thiazol-2-yl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3871665 |
| Molecular Formula | C16H19N3O6S2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 3-(carboxymethyl)-5-(3-methylsulfanylpropyl)-4,6-dioxo-1-(1,3-thiazol-2-yl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CSCCCN1C(=O)C2C(c3nccs3)NC(CC(=O)O)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C16H19N3O6S2/c1-26-5-2-4-19-13(22)9-10(14(19)23)16(15(24)25,7-8(20)21)18-11(9)12-17-3-6-27-12/h3,6,9-11,18H,2,4-5,7H2,1H3,(H,20,21)(H,24,25) |
| InChIKey | JYEABLMXDIDNJC-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 136.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|