C22H27F3N2O4 — CID 3873068
5-tert-butyl-3-(2-methylpropyl)-4,6-dioxo-1-[4-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3873068) has the molecular formula C22H27F3N2O4 and a molecular weight of 440.46 g/mol. Its IUPAC name is 5-tert-butyl-3-(2-methylpropyl)-4,6-dioxo-1-[4-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-tert-butyl-3-(2-methylpropyl)-4,6-dioxo-1-[4-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3873068 |
| Molecular Formula | C22H27F3N2O4 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 5-tert-butyl-3-(2-methylpropyl)-4,6-dioxo-1-[4-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CC(C)CC1(C(=O)O)NC(c2ccc(C(F)(F)F)cc2)C2C(=O)N(C(C)(C)C)C(=O)C21 |
| InChI | InChI=1S/C22H27F3N2O4/c1-11(2)10-21(19(30)31)15-14(17(28)27(18(15)29)20(3,4)5)16(26-21)12-6-8-13(9-7-12)22(23,24)25/h6-9,11,14-16,26H,10H2,1-5H3,(H,30,31) |
| InChIKey | AACUAXRIHBFLQY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|