About 2-isocyanobenzonitrile
2-isocyanobenzonitrile (PubChem CID 3873366) has the molecular formula C8H4N2
and a molecular weight of 128.13 g/mol. Its IUPAC name is 2-isocyanobenzonitrile.
Molecular Properties
| Compound Name | 2-isocyanobenzonitrile |
| PubChem CID | 3873366 |
| Molecular Formula | C8H4N2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | 2-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1ccccc1C#N |
| InChI | InChI=1S/C8H4N2/c1-10-8-5-3-2-4-7(8)6-9/h2-5H |
| InChIKey | HTMWQSKIYNDFNU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanobenzonitrile?
The IUPAC name of 2-isocyanobenzonitrile (CID 3873366) is 2-isocyanobenzonitrile.
What is the SMILES notation for 2-isocyanobenzonitrile?
The canonical SMILES for 2-isocyanobenzonitrile is [C-]#[N+]c1ccccc1C#N.
What is the InChIKey of 2-isocyanobenzonitrile?
The InChIKey is HTMWQSKIYNDFNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2/c1-10-8-5-3-2-4-7(8)6-9/h2-5H.
What are the key properties of 2-isocyanobenzonitrile?
2-isocyanobenzonitrile has a molecular weight of 128.13 g/mol, XLogP of 2.11, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanobenzonitrile is sourced from PubChem (CID 3873366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).