C30H26N2O3S — CID 3873731
[2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate (PubChem CID 3873731) has the molecular formula C30H26N2O3S and a molecular weight of 494.62 g/mol. Its IUPAC name is [2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate.
| Compound Name | [2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 3873731 |
| Molecular Formula | C30H26N2O3S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | [2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)COC(=O)c3cc(-c4cccs4)nc4ccccc34)c2C)cc1C |
| InChI | InChI=1S/C30H26N2O3S/c1-18-11-12-22(14-19(18)2)32-20(3)15-24(21(32)4)28(33)17-35-30(34)25-16-27(29-10-7-13-36-29)31-26-9-6-5-8-23(25)26/h5-16H,17H2,1-4H3 |
| InChIKey | DQEBLJSROMRSLQ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|