About 4-[(3,5,7-trimethyl-1-adamantyl)methyliminomethyl]phenol
4-[(3,5,7-trimethyl-1-adamantyl)methyliminomethyl]phenol (PubChem CID 3874521) has the molecular formula C21H29NO
and a molecular weight of 311.47 g/mol. Its IUPAC name is 4-[(3,5,7-trimethyl-1-adamantyl)methyliminomethyl]phenol.
Molecular Properties
| Compound Name | 4-[(3,5,7-trimethyl-1-adamantyl)methyliminomethyl]phenol |
| PubChem CID | 3874521 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 4-[(3,5,7-trimethyl-1-adamantyl)methyliminomethyl]phenol |
| SMILES | CC12CC3(C)CC(C)(C1)CC(C/N=C/c1ccc(O)cc1)(C2)C3 |
| InChI | InChI=1S/C21H29NO/c1-18-9-19(2)11-20(3,10-18)14-21(12-18,13-19)15-22-8-16-4-6-17(23)7-5-16/h4-8,23H,9-15H2,1-3H3/b22-8+ |
| InChIKey | VJBZUJMOPICFBP-GZIVZEMBSA-N |
| XLogP | 5.20 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3,5,7-trimethyl-1-adamantyl)methyliminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,5,7-trimethyl-1-adamantyl)methyliminomethyl]phenol?
The IUPAC name of 4-[(3,5,7-trimethyl-1-adamantyl)methyliminomethyl]phenol (CID 3874521) is 4-[(3,5,7-trimethyl-1-adamantyl)methyliminomethyl]phenol.
What is the SMILES notation for 4-[(3,5,7-trimethyl-1-adamantyl)methyliminomethyl]phenol?
The canonical SMILES for 4-[(3,5,7-trimethyl-1-adamantyl)methyliminomethyl]phenol is CC12CC3(C)CC(C)(C1)CC(C/N=C/c1ccc(O)cc1)(C2)C3.
What is the InChIKey of 4-[(3,5,7-trimethyl-1-adamantyl)methyliminomethyl]phenol?
The InChIKey is VJBZUJMOPICFBP-GZIVZEMBSA-N. The full InChI is InChI=1S/C21H29NO/c1-18-9-19(2)11-20(3,10-18)14-21(12-18,13-19)15-22-8-16-4-6-17(23)7-5-16/h4-8,23H,9-15H2,1-3H3/b22-8+.
What are the key properties of 4-[(3,5,7-trimethyl-1-adamantyl)methyliminomethyl]phenol?
4-[(3,5,7-trimethyl-1-adamantyl)methyliminomethyl]phenol has a molecular weight of 311.47 g/mol, XLogP of 5.20, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,5,7-trimethyl-1-adamantyl)methyliminomethyl]phenol is sourced from PubChem (CID 3874521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).