C29H32FN3O2 — CID 3875003
[2-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3-fluorobenzoate (PubChem CID 3875003) has the molecular formula C29H32FN3O2 and a molecular weight of 473.59 g/mol. Its IUPAC name is [2-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3-fluorobenzoate.
| Compound Name | [2-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 3875003 |
| Molecular Formula | C29H32FN3O2 |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | [2-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3-fluorobenzoate |
| SMILES | Cc1ccn2c(NC(C)(C)CC(C)(C)C)c(-c3ccccc3OC(=O)c3cccc(F)c3)nc2c1 |
| InChI | InChI=1S/C29H32FN3O2/c1-19-14-15-33-24(16-19)31-25(26(33)32-29(5,6)18-28(2,3)4)22-12-7-8-13-23(22)35-27(34)20-10-9-11-21(30)17-20/h7-17,32H,18H2,1-6H3 |
| InChIKey | MYGOZWPGWNPTMH-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|