C18H17F3INO2 — CID 3875364
3-butoxy-N-[4-iodo-2-(trifluoromethyl)phenyl]benzamide (PubChem CID 3875364) has the molecular formula C18H17F3INO2 and a molecular weight of 463.24 g/mol. Its IUPAC name is 3-butoxy-N-[4-iodo-2-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-butoxy-N-[4-iodo-2-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 3875364 |
| Molecular Formula | C18H17F3INO2 |
| Molecular Weight | 463.24 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | 3-butoxy-N-[4-iodo-2-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCCCOc1cccc(C(=O)Nc2ccc(I)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17F3INO2/c1-2-3-9-25-14-6-4-5-12(10-14)17(24)23-16-8-7-13(22)11-15(16)18(19,20)21/h4-8,10-11H,2-3,9H2,1H3,(H,23,24) |
| InChIKey | YWHRFDXIJKKFMF-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.24 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|