C20H21N5O3 — CID 38756771
N-[2-[(5-cyano-2-pyridinyl)amino]ethyl]-2-[3-(2-oxopyrrolidin-1-yl)phenoxy]acetamide (PubChem CID 38756771) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-[2-[(5-cyano-2-pyridinyl)amino]ethyl]-2-[3-(2-oxopyrrolidin-1-yl)phenoxy]acetamide.
| Compound Name | N-[2-[(5-cyano-2-pyridinyl)amino]ethyl]-2-[3-(2-oxopyrrolidin-1-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 38756771 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[2-[(5-cyano-2-pyridinyl)amino]ethyl]-2-[3-(2-oxopyrrolidin-1-yl)phenoxy]acetamide |
| SMILES | N#Cc1ccc(NCCNC(=O)COc2cccc(N3CCCC3=O)c2)nc1 |
| InChI | InChI=1S/C20H21N5O3/c21-12-15-6-7-18(24-13-15)22-8-9-23-19(26)14-28-17-4-1-3-16(11-17)25-10-2-5-20(25)27/h1,3-4,6-7,11,13H,2,5,8-10,14H2,(H,22,24)(H,23,26) |
| InChIKey | YWSSDPMIIFPRBN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|