C18H14ClNO2 — CID 3876449
2-(2-chlorophenyl)-4-[(4-ethylphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 3876449) has the molecular formula C18H14ClNO2 and a molecular weight of 311.77 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4-[(4-ethylphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | 2-(2-chlorophenyl)-4-[(4-ethylphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 3876449 |
| Molecular Formula | C18H14ClNO2 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-(2-chlorophenyl)-4-[(4-ethylphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | CCc1ccc(C=C2N=C(c3ccccc3Cl)OC2=O)cc1 |
| InChI | InChI=1S/C18H14ClNO2/c1-2-12-7-9-13(10-8-12)11-16-18(21)22-17(20-16)14-5-3-4-6-15(14)19/h3-11H,2H2,1H3 |
| InChIKey | RIIWFPGHCPKFBD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|