C29H38N6 — CID 3876501
2-N,2-N-dicyclohexyl-6-N,6-N-dimethyl-4-N,4-N-diphenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 3876501) has the molecular formula C29H38N6 and a molecular weight of 470.67 g/mol. Its IUPAC name is 2-N,2-N-dicyclohexyl-6-N,6-N-dimethyl-4-N,4-N-diphenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-dicyclohexyl-6-N,6-N-dimethyl-4-N,4-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 3876501 |
| Molecular Formula | C29H38N6 |
| Molecular Weight | 470.67 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | 2-N,2-N-dicyclohexyl-6-N,6-N-dimethyl-4-N,4-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)c1nc(N(c2ccccc2)c2ccccc2)nc(N(C2CCCCC2)C2CCCCC2)n1 |
| InChI | InChI=1S/C29H38N6/c1-33(2)27-30-28(34(23-15-7-3-8-16-23)24-17-9-4-10-18-24)32-29(31-27)35(25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-4,7-10,15-18,25-26H,5-6,11-14,19-22H2,1-2H3 |
| InChIKey | WOUIRDTVVISQJJ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.67 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |