C14H21N3O2 — CID 3877589
6-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-3-methyl-1H-pyrimidine-2,4-dione (PubChem CID 3877589) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 6-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-3-methyl-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-3-methyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3877589 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 6-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-3-methyl-1H-pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)cc(N2CCCC3CCCCC32)[nH]c1=O |
| InChI | InChI=1S/C14H21N3O2/c1-16-13(18)9-12(15-14(16)19)17-8-4-6-10-5-2-3-7-11(10)17/h9-11H,2-8H2,1H3,(H,15,19) |
| InChIKey | XSUGNINQKAQGBT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |