About 3-(1,3-benzodioxol-5-ylmethylideneamino)-2-methyl-2-(3-nitrophenyl)-1H-quinazolin-4-one
3-(1,3-benzodioxol-5-ylmethylideneamino)-2-methyl-2-(3-nitrophenyl)-1H-quinazolin-4-one (PubChem CID 3877629) has the molecular formula C23H18N4O5
and a molecular weight of 430.42 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylideneamino)-2-methyl-2-(3-nitrophenyl)-1H-quinazolin-4-one.
Molecular Properties
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylideneamino)-2-methyl-2-(3-nitrophenyl)-1H-quinazolin-4-one |
| PubChem CID | 3877629 |
| Molecular Formula | C23H18N4O5 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylideneamino)-2-methyl-2-(3-nitrophenyl)-1H-quinazolin-4-one |
| SMILES | CC1(c2cccc([N+](=O)[O-])c2)Nc2ccccc2C(=O)N1N=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H18N4O5/c1-23(16-5-4-6-17(12-16)27(29)30)25-19-8-3-2-7-18(19)22(28)26(23)24-13-15-9-10-20-21(11-15)32-14-31-20/h2-13,25H,14H2,1H3 |
| InChIKey | SWIHEQFPTJTPFX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,3-benzodioxol-5-ylmethylideneamino)-2-methyl-2-(3-nitrophenyl)-1H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzodioxol-5-ylmethylideneamino)-2-methyl-2-(3-nitrophenyl)-1H-quinazolin-4-one?
The IUPAC name of 3-(1,3-benzodioxol-5-ylmethylideneamino)-2-methyl-2-(3-nitrophenyl)-1H-quinazolin-4-one (CID 3877629) is 3-(1,3-benzodioxol-5-ylmethylideneamino)-2-methyl-2-(3-nitrophenyl)-1H-quinazolin-4-one.
What is the SMILES notation for 3-(1,3-benzodioxol-5-ylmethylideneamino)-2-methyl-2-(3-nitrophenyl)-1H-quinazolin-4-one?
The canonical SMILES for 3-(1,3-benzodioxol-5-ylmethylideneamino)-2-methyl-2-(3-nitrophenyl)-1H-quinazolin-4-one is CC1(c2cccc([N+](=O)[O-])c2)Nc2ccccc2C(=O)N1N=Cc1ccc2c(c1)OCO2.
What is the InChIKey of 3-(1,3-benzodioxol-5-ylmethylideneamino)-2-methyl-2-(3-nitrophenyl)-1H-quinazolin-4-one?
The InChIKey is SWIHEQFPTJTPFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N4O5/c1-23(16-5-4-6-17(12-16)27(29)30)25-19-8-3-2-7-18(19)22(28)26(23)24-13-15-9-10-20-21(11-15)32-14-31-20/h2-13,25H,14H2,1H3.
What are the key properties of 3-(1,3-benzodioxol-5-ylmethylideneamino)-2-methyl-2-(3-nitrophenyl)-1H-quinazolin-4-one?
3-(1,3-benzodioxol-5-ylmethylideneamino)-2-methyl-2-(3-nitrophenyl)-1H-quinazolin-4-one has a molecular weight of 430.42 g/mol, XLogP of 4.10, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzodioxol-5-ylmethylideneamino)-2-methyl-2-(3-nitrophenyl)-1H-quinazolin-4-one is sourced from PubChem (CID 3877629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).