About ethyl 2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)acetate
ethyl 2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)acetate (PubChem CID 3877893) has the molecular formula C14H18N2O3
and a molecular weight of 262.31 g/mol. Its IUPAC name is ethyl 2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)acetate |
| PubChem CID | 3877893 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | ethyl 2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)acetate |
| SMILES | CCOC(=O)CN1c2ccccc2NC(=O)CC1C |
| InChI | InChI=1S/C14H18N2O3/c1-3-19-14(18)9-16-10(2)8-13(17)15-11-6-4-5-7-12(11)16/h4-7,10H,3,8-9H2,1-2H3,(H,15,17) |
| InChIKey | QLROZEUYLDKMOP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)acetate?
The IUPAC name of ethyl 2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)acetate (CID 3877893) is ethyl 2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)acetate.
What is the SMILES notation for ethyl 2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)acetate?
The canonical SMILES for ethyl 2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)acetate is CCOC(=O)CN1c2ccccc2NC(=O)CC1C.
What is the InChIKey of ethyl 2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)acetate?
The InChIKey is QLROZEUYLDKMOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3/c1-3-19-14(18)9-16-10(2)8-13(17)15-11-6-4-5-7-12(11)16/h4-7,10H,3,8-9H2,1-2H3,(H,15,17).
What are the key properties of ethyl 2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)acetate?
ethyl 2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)acetate has a molecular weight of 262.31 g/mol, XLogP of 1.79, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)acetate is sourced from PubChem (CID 3877893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).