C17H17ClINO3 — CID 3878206
N-(2-chlorophenyl)-3,4-diethoxy-5-iodobenzamide (PubChem CID 3878206) has the molecular formula C17H17ClINO3 and a molecular weight of 445.68 g/mol. Its IUPAC name is N-(2-chlorophenyl)-3,4-diethoxy-5-iodobenzamide.
| Compound Name | N-(2-chlorophenyl)-3,4-diethoxy-5-iodobenzamide |
|---|---|
| PubChem CID | 3878206 |
| Molecular Formula | C17H17ClINO3 |
| Molecular Weight | 445.68 g/mol |
| Exact Mass | 444.99 |
| IUPAC Name | N-(2-chlorophenyl)-3,4-diethoxy-5-iodobenzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccccc2Cl)cc(I)c1OCC |
| InChI | InChI=1S/C17H17ClINO3/c1-3-22-15-10-11(9-13(19)16(15)23-4-2)17(21)20-14-8-6-5-7-12(14)18/h5-10H,3-4H2,1-2H3,(H,20,21) |
| InChIKey | ZHUFRYOWYHFMGW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.68 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|