About 2-(1H-1,2,4-triazol-5-ylsulfanyl)-1-[(3R)-3-(trifluoromethyl)piperidin-1-yl]ethanone
2-(1H-1,2,4-triazol-5-ylsulfanyl)-1-[(3R)-3-(trifluoromethyl)piperidin-1-yl]ethanone (PubChem CID 38793824) has the molecular formula C10H13F3N4OS
and a molecular weight of 294.30 g/mol. Its IUPAC name is 2-(1H-1,2,4-triazol-5-ylsulfanyl)-1-[(3R)-3-(trifluoromethyl)piperidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 2-(1H-1,2,4-triazol-5-ylsulfanyl)-1-[(3R)-3-(trifluoromethyl)piperidin-1-yl]ethanone |
| PubChem CID | 38793824 |
| Molecular Formula | C10H13F3N4OS |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2-(1H-1,2,4-triazol-5-ylsulfanyl)-1-[(3R)-3-(trifluoromethyl)piperidin-1-yl]ethanone |
| SMILES | O=C(CSc1ncn[nH]1)N1CCC[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C10H13F3N4OS/c11-10(12,13)7-2-1-3-17(4-7)8(18)5-19-9-14-6-15-16-9/h6-7H,1-5H2,(H,14,15,16)/t7-/m1/s1 |
| InChIKey | AGUBQRIHFJVTBT-SSDOTTSWSA-N |
| XLogP | 1.70 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1H-1,2,4-triazol-5-ylsulfanyl)-1-[(3R)-3-(trifluoromethyl)piperidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-1,2,4-triazol-5-ylsulfanyl)-1-[(3R)-3-(trifluoromethyl)piperidin-1-yl]ethanone?
The IUPAC name of 2-(1H-1,2,4-triazol-5-ylsulfanyl)-1-[(3R)-3-(trifluoromethyl)piperidin-1-yl]ethanone (CID 38793824) is 2-(1H-1,2,4-triazol-5-ylsulfanyl)-1-[(3R)-3-(trifluoromethyl)piperidin-1-yl]ethanone.
What is the SMILES notation for 2-(1H-1,2,4-triazol-5-ylsulfanyl)-1-[(3R)-3-(trifluoromethyl)piperidin-1-yl]ethanone?
The canonical SMILES for 2-(1H-1,2,4-triazol-5-ylsulfanyl)-1-[(3R)-3-(trifluoromethyl)piperidin-1-yl]ethanone is O=C(CSc1ncn[nH]1)N1CCC[C@@H](C(F)(F)F)C1.
What is the InChIKey of 2-(1H-1,2,4-triazol-5-ylsulfanyl)-1-[(3R)-3-(trifluoromethyl)piperidin-1-yl]ethanone?
The InChIKey is AGUBQRIHFJVTBT-SSDOTTSWSA-N. The full InChI is InChI=1S/C10H13F3N4OS/c11-10(12,13)7-2-1-3-17(4-7)8(18)5-19-9-14-6-15-16-9/h6-7H,1-5H2,(H,14,15,16)/t7-/m1/s1.
What are the key properties of 2-(1H-1,2,4-triazol-5-ylsulfanyl)-1-[(3R)-3-(trifluoromethyl)piperidin-1-yl]ethanone?
2-(1H-1,2,4-triazol-5-ylsulfanyl)-1-[(3R)-3-(trifluoromethyl)piperidin-1-yl]ethanone has a molecular weight of 294.30 g/mol, XLogP of 1.70, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-1,2,4-triazol-5-ylsulfanyl)-1-[(3R)-3-(trifluoromethyl)piperidin-1-yl]ethanone is sourced from PubChem (CID 38793824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).