C22H25N3O4S — CID 38802258
(3S)-1-(benzenesulfonyl)-N-[3-(2-oxopyrrolidin-1-yl)phenyl]piperidine-3-carboxamide (PubChem CID 38802258) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is (3S)-1-(benzenesulfonyl)-N-[3-(2-oxopyrrolidin-1-yl)phenyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-(benzenesulfonyl)-N-[3-(2-oxopyrrolidin-1-yl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 38802258 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | (3S)-1-(benzenesulfonyl)-N-[3-(2-oxopyrrolidin-1-yl)phenyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(N2CCCC2=O)c1)[C@H]1CCCN(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C22H25N3O4S/c26-21-12-6-14-25(21)19-9-4-8-18(15-19)23-22(27)17-7-5-13-24(16-17)30(28,29)20-10-2-1-3-11-20/h1-4,8-11,15,17H,5-7,12-14,16H2,(H,23,27)/t17-/m0/s1 |
| InChIKey | DEWSLVZWIHTUBA-KRWDZBQOSA-N |
| XLogP | 2.85 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |