C16H15BrN2O4 — CID 3880243
[[amino-(3-bromophenyl)methylidene]amino] 2-(2-methoxyphenoxy)acetate (PubChem CID 3880243) has the molecular formula C16H15BrN2O4 and a molecular weight of 379.21 g/mol. Its IUPAC name is [[amino-(3-bromophenyl)methylidene]amino] 2-(2-methoxyphenoxy)acetate.
| Compound Name | [[amino-(3-bromophenyl)methylidene]amino] 2-(2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 3880243 |
| Molecular Formula | C16H15BrN2O4 |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | [[amino-(3-bromophenyl)methylidene]amino] 2-(2-methoxyphenoxy)acetate |
| SMILES | COc1ccccc1OCC(=O)ON=C(N)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H15BrN2O4/c1-21-13-7-2-3-8-14(13)22-10-15(20)23-19-16(18)11-5-4-6-12(17)9-11/h2-9H,10H2,1H3,(H2,18,19) |
| InChIKey | OCSFZQCWHSYVAU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|