C16H10ClF2N3O — CID 38802898
N-(3-chloro-2-fluorophenyl)-1-(4-fluorophenyl)pyrazole-3-carboxamide (PubChem CID 38802898) has the molecular formula C16H10ClF2N3O and a molecular weight of 333.73 g/mol. Its IUPAC name is N-(3-chloro-2-fluorophenyl)-1-(4-fluorophenyl)pyrazole-3-carboxamide.
| Compound Name | N-(3-chloro-2-fluorophenyl)-1-(4-fluorophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 38802898 |
| Molecular Formula | C16H10ClF2N3O |
| Molecular Weight | 333.73 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | N-(3-chloro-2-fluorophenyl)-1-(4-fluorophenyl)pyrazole-3-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1F)c1ccn(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C16H10ClF2N3O/c17-12-2-1-3-13(15(12)19)20-16(23)14-8-9-22(21-14)11-6-4-10(18)5-7-11/h1-9H,(H,20,23) |
| InChIKey | JGGZHHDUTXRGSU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.73 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |