About N-(1,3-benzothiazol-2-ylmethyl)-2-(5-bromo-2-methyl-1H-indol-3-yl)-N-methylacetamide
N-(1,3-benzothiazol-2-ylmethyl)-2-(5-bromo-2-methyl-1H-indol-3-yl)-N-methylacetamide (PubChem CID 38819272) has the molecular formula C20H18BrN3OS
and a molecular weight of 428.36 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-2-(5-bromo-2-methyl-1H-indol-3-yl)-N-methylacetamide.
Molecular Properties
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-2-(5-bromo-2-methyl-1H-indol-3-yl)-N-methylacetamide |
| PubChem CID | 38819272 |
| Molecular Formula | C20H18BrN3OS |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-2-(5-bromo-2-methyl-1H-indol-3-yl)-N-methylacetamide |
| SMILES | Cc1[nH]c2ccc(Br)cc2c1CC(=O)N(C)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C20H18BrN3OS/c1-12-14(15-9-13(21)7-8-16(15)22-12)10-20(25)24(2)11-19-23-17-5-3-4-6-18(17)26-19/h3-9,22H,10-11H2,1-2H3 |
| InChIKey | OTSCIOFSOWSYFJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-benzothiazol-2-ylmethyl)-2-(5-bromo-2-methyl-1H-indol-3-yl)-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzothiazol-2-ylmethyl)-2-(5-bromo-2-methyl-1H-indol-3-yl)-N-methylacetamide?
The IUPAC name of N-(1,3-benzothiazol-2-ylmethyl)-2-(5-bromo-2-methyl-1H-indol-3-yl)-N-methylacetamide (CID 38819272) is N-(1,3-benzothiazol-2-ylmethyl)-2-(5-bromo-2-methyl-1H-indol-3-yl)-N-methylacetamide.
What is the SMILES notation for N-(1,3-benzothiazol-2-ylmethyl)-2-(5-bromo-2-methyl-1H-indol-3-yl)-N-methylacetamide?
The canonical SMILES for N-(1,3-benzothiazol-2-ylmethyl)-2-(5-bromo-2-methyl-1H-indol-3-yl)-N-methylacetamide is Cc1[nH]c2ccc(Br)cc2c1CC(=O)N(C)Cc1nc2ccccc2s1.
What is the InChIKey of N-(1,3-benzothiazol-2-ylmethyl)-2-(5-bromo-2-methyl-1H-indol-3-yl)-N-methylacetamide?
The InChIKey is OTSCIOFSOWSYFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18BrN3OS/c1-12-14(15-9-13(21)7-8-16(15)22-12)10-20(25)24(2)11-19-23-17-5-3-4-6-18(17)26-19/h3-9,22H,10-11H2,1-2H3.
What are the key properties of N-(1,3-benzothiazol-2-ylmethyl)-2-(5-bromo-2-methyl-1H-indol-3-yl)-N-methylacetamide?
N-(1,3-benzothiazol-2-ylmethyl)-2-(5-bromo-2-methyl-1H-indol-3-yl)-N-methylacetamide has a molecular weight of 428.36 g/mol, XLogP of 5.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzothiazol-2-ylmethyl)-2-(5-bromo-2-methyl-1H-indol-3-yl)-N-methylacetamide is sourced from PubChem (CID 38819272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).