About 2'-pyridin-2-ylspiro[1H-indole-3,1'-cyclopropane]-2-one
2'-pyridin-2-ylspiro[1H-indole-3,1'-cyclopropane]-2-one (PubChem CID 3882374) has the molecular formula C15H12N2O
and a molecular weight of 236.27 g/mol. Its IUPAC name is 2'-pyridin-2-ylspiro[1H-indole-3,1'-cyclopropane]-2-one.
Molecular Properties
| Compound Name | 2'-pyridin-2-ylspiro[1H-indole-3,1'-cyclopropane]-2-one |
| PubChem CID | 3882374 |
| Molecular Formula | C15H12N2O |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 2'-pyridin-2-ylspiro[1H-indole-3,1'-cyclopropane]-2-one |
| SMILES | O=C1Nc2ccccc2C12CC2c1ccccn1 |
| InChI | InChI=1S/C15H12N2O/c18-14-15(10-5-1-2-7-13(10)17-14)9-11(15)12-6-3-4-8-16-12/h1-8,11H,9H2,(H,17,18) |
| InChIKey | ZCZVSRKERIIHOL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2'-pyridin-2-ylspiro[1H-indole-3,1'-cyclopropane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-pyridin-2-ylspiro[1H-indole-3,1'-cyclopropane]-2-one?
The IUPAC name of 2'-pyridin-2-ylspiro[1H-indole-3,1'-cyclopropane]-2-one (CID 3882374) is 2'-pyridin-2-ylspiro[1H-indole-3,1'-cyclopropane]-2-one.
What is the SMILES notation for 2'-pyridin-2-ylspiro[1H-indole-3,1'-cyclopropane]-2-one?
The canonical SMILES for 2'-pyridin-2-ylspiro[1H-indole-3,1'-cyclopropane]-2-one is O=C1Nc2ccccc2C12CC2c1ccccn1.
What is the InChIKey of 2'-pyridin-2-ylspiro[1H-indole-3,1'-cyclopropane]-2-one?
The InChIKey is ZCZVSRKERIIHOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O/c18-14-15(10-5-1-2-7-13(10)17-14)9-11(15)12-6-3-4-8-16-12/h1-8,11H,9H2,(H,17,18).
What are the key properties of 2'-pyridin-2-ylspiro[1H-indole-3,1'-cyclopropane]-2-one?
2'-pyridin-2-ylspiro[1H-indole-3,1'-cyclopropane]-2-one has a molecular weight of 236.27 g/mol, XLogP of 2.46, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-pyridin-2-ylspiro[1H-indole-3,1'-cyclopropane]-2-one is sourced from PubChem (CID 3882374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).