C11H15F3N2O4S — CID 38835018
5-(tert-butylsulfamoyl)-N-(2,2,2-trifluoroethyl)furan-2-carboxamide (PubChem CID 38835018) has the molecular formula C11H15F3N2O4S and a molecular weight of 328.31 g/mol. Its IUPAC name is 5-(tert-butylsulfamoyl)-N-(2,2,2-trifluoroethyl)furan-2-carboxamide.
| Compound Name | 5-(tert-butylsulfamoyl)-N-(2,2,2-trifluoroethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 38835018 |
| Molecular Formula | C11H15F3N2O4S |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 5-(tert-butylsulfamoyl)-N-(2,2,2-trifluoroethyl)furan-2-carboxamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(C(=O)NCC(F)(F)F)o1 |
| InChI | InChI=1S/C11H15F3N2O4S/c1-10(2,3)16-21(18,19)8-5-4-7(20-8)9(17)15-6-11(12,13)14/h4-5,16H,6H2,1-3H3,(H,15,17) |
| InChIKey | SNKNKFXGCWWKAV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |