C48H42N2O3 — CID 3883725
2-[2-oxo-2-[2,2,4-trimethyl-4-(4-methylphenyl)-6-trityl-3H-quinolin-1-yl]ethyl]isoindole-1,3-dione (PubChem CID 3883725) has the molecular formula C48H42N2O3 and a molecular weight of 694.88 g/mol. Its IUPAC name is 2-[2-oxo-2-[2,2,4-trimethyl-4-(4-methylphenyl)-6-trityl-3H-quinolin-1-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-oxo-2-[2,2,4-trimethyl-4-(4-methylphenyl)-6-trityl-3H-quinolin-1-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 3883725 |
| Molecular Formula | C48H42N2O3 |
| Molecular Weight | 694.88 g/mol |
| Exact Mass | 694.32 |
| IUPAC Name | 2-[2-oxo-2-[2,2,4-trimethyl-4-(4-methylphenyl)-6-trityl-3H-quinolin-1-yl]ethyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(C2(C)CC(C)(C)N(C(=O)CN3C(=O)c4ccccc4C3=O)c3ccc(C(c4ccccc4)(c4ccccc4)c4ccccc4)cc32)cc1 |
| InChI | InChI=1S/C48H42N2O3/c1-33-24-26-34(27-25-33)47(4)32-46(2,3)50(43(51)31-49-44(52)39-22-14-15-23-40(39)45(49)53)42-29-28-38(30-41(42)47)48(35-16-8-5-9-17-35,36-18-10-6-11-19-36)37-20-12-7-13-21-37/h5-30H,31-32H2,1-4H3 |
| InChIKey | KTYHCAXRYQTVQU-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.88 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|