C25H28N2O — CID 3884218
4-[2-(1-methoxynaphthalen-2-yl)-4,6-dimethyl-1H-indol-3-yl]butan-1-amine (PubChem CID 3884218) has the molecular formula C25H28N2O and a molecular weight of 372.51 g/mol. Its IUPAC name is 4-[2-(1-methoxynaphthalen-2-yl)-4,6-dimethyl-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(1-methoxynaphthalen-2-yl)-4,6-dimethyl-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3884218 |
| Molecular Formula | C25H28N2O |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 4-[2-(1-methoxynaphthalen-2-yl)-4,6-dimethyl-1H-indol-3-yl]butan-1-amine |
| SMILES | COc1c(-c2[nH]c3cc(C)cc(C)c3c2CCCCN)ccc2ccccc12 |
| InChI | InChI=1S/C25H28N2O/c1-16-14-17(2)23-20(10-6-7-13-26)24(27-22(23)15-16)21-12-11-18-8-4-5-9-19(18)25(21)28-3/h4-5,8-9,11-12,14-15,27H,6-7,10,13,26H2,1-3H3 |
| InChIKey | JZVKINCUHWKCIX-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|