About methyl 2-[1-[2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]acetyl]-3-oxopiperazin-2-yl]acetate
methyl 2-[1-[2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]acetyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 3884239) has the molecular formula C16H16ClN3O5S
and a molecular weight of 397.84 g/mol. Its IUPAC name is methyl 2-[1-[2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]acetyl]-3-oxopiperazin-2-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[1-[2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]acetyl]-3-oxopiperazin-2-yl]acetate |
| PubChem CID | 3884239 |
| Molecular Formula | C16H16ClN3O5S |
| Molecular Weight | 397.84 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | methyl 2-[1-[2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]acetyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | COC(=O)CC1C(=O)NCCN1C(=O)CSc1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C16H16ClN3O5S/c1-24-14(22)7-11-15(23)18-4-5-20(11)13(21)8-26-16-19-10-6-9(17)2-3-12(10)25-16/h2-3,6,11H,4-5,7-8H2,1H3,(H,18,23) |
| InChIKey | MDVBCCWPJZXSMR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.84 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[1-[2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]acetyl]-3-oxopiperazin-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[1-[2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]acetyl]-3-oxopiperazin-2-yl]acetate?
The IUPAC name of methyl 2-[1-[2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]acetyl]-3-oxopiperazin-2-yl]acetate (CID 3884239) is methyl 2-[1-[2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]acetyl]-3-oxopiperazin-2-yl]acetate.
What is the SMILES notation for methyl 2-[1-[2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]acetyl]-3-oxopiperazin-2-yl]acetate?
The canonical SMILES for methyl 2-[1-[2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]acetyl]-3-oxopiperazin-2-yl]acetate is COC(=O)CC1C(=O)NCCN1C(=O)CSc1nc2cc(Cl)ccc2o1.
What is the InChIKey of methyl 2-[1-[2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]acetyl]-3-oxopiperazin-2-yl]acetate?
The InChIKey is MDVBCCWPJZXSMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClN3O5S/c1-24-14(22)7-11-15(23)18-4-5-20(11)13(21)8-26-16-19-10-6-9(17)2-3-12(10)25-16/h2-3,6,11H,4-5,7-8H2,1H3,(H,18,23).
What are the key properties of methyl 2-[1-[2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]acetyl]-3-oxopiperazin-2-yl]acetate?
methyl 2-[1-[2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]acetyl]-3-oxopiperazin-2-yl]acetate has a molecular weight of 397.84 g/mol, XLogP of 1.46, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-[2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]acetyl]-3-oxopiperazin-2-yl]acetate is sourced from PubChem (CID 3884239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).