C11H18N6O2 — CID 3884387
6-(azepan-1-yl)-2-N-methyl-5-nitropyrimidine-2,4-diamine (PubChem CID 3884387) has the molecular formula C11H18N6O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 6-(azepan-1-yl)-2-N-methyl-5-nitropyrimidine-2,4-diamine.
| Compound Name | 6-(azepan-1-yl)-2-N-methyl-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 3884387 |
| Molecular Formula | C11H18N6O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 6-(azepan-1-yl)-2-N-methyl-5-nitropyrimidine-2,4-diamine |
| SMILES | CNc1nc(N)c([N+](=O)[O-])c(N2CCCCCC2)n1 |
| InChI | InChI=1S/C11H18N6O2/c1-13-11-14-9(12)8(17(18)19)10(15-11)16-6-4-2-3-5-7-16/h2-7H2,1H3,(H3,12,13,14,15) |
| InChIKey | GRVUVFAIJCLCPT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|