C23H33NO4 — CID 3884662
12-ethyl-7,17-dihydroxy-14-methyl-6-methylidene-12-oxido-12-azoniahexacyclo[8.7.2.15,8.01,11.02,8.014,18]icosan-4-one (PubChem CID 3884662) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is 12-ethyl-7,17-dihydroxy-14-methyl-6-methylidene-12-oxido-12-azoniahexacyclo[8.7.2.15,8.01,11.02,8.014,18]icosan-4-one.
| Compound Name | 12-ethyl-7,17-dihydroxy-14-methyl-6-methylidene-12-oxido-12-azoniahexacyclo[8.7.2.15,8.01,11.02,8.014,18]icosan-4-one |
|---|---|
| PubChem CID | 3884662 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 12-ethyl-7,17-dihydroxy-14-methyl-6-methylidene-12-oxido-12-azoniahexacyclo[8.7.2.15,8.01,11.02,8.014,18]icosan-4-one |
| SMILES | C=C1C2CC3(CC4CC5C6(C)CCC(O)C5(C3CC2=O)C4[N+]([O-])(CC)C6)C1O |
| InChI | InChI=1S/C23H33NO4/c1-4-24(28)11-21(3)6-5-18(26)23-16(21)7-13(19(23)24)9-22-10-14(12(2)20(22)27)15(25)8-17(22)23/h13-14,16-20,26-27H,2,4-11H2,1,3H3 |
| InChIKey | WIHJXSMIOMLZJA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|