C19H19N3OS — CID 3884704
3,4-dimethyl-N-[5-(2-phenylethyl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 3884704) has the molecular formula C19H19N3OS and a molecular weight of 337.45 g/mol. Its IUPAC name is 3,4-dimethyl-N-[5-(2-phenylethyl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3,4-dimethyl-N-[5-(2-phenylethyl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 3884704 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 3,4-dimethyl-N-[5-(2-phenylethyl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2nnc(CCc3ccccc3)s2)cc1C |
| InChI | InChI=1S/C19H19N3OS/c1-13-8-10-16(12-14(13)2)18(23)20-19-22-21-17(24-19)11-9-15-6-4-3-5-7-15/h3-8,10,12H,9,11H2,1-2H3,(H,20,22,23) |
| InChIKey | WPZDSKXEQWEKHA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |