About N-prop-2-enyl-1H-1,2,4-triazole-5-sulfonamide
N-prop-2-enyl-1H-1,2,4-triazole-5-sulfonamide (PubChem CID 3884828) has the molecular formula C5H8N4O2S
and a molecular weight of 188.21 g/mol. Its IUPAC name is N-prop-2-enyl-1H-1,2,4-triazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-prop-2-enyl-1H-1,2,4-triazole-5-sulfonamide |
| PubChem CID | 3884828 |
| Molecular Formula | C5H8N4O2S |
| Molecular Weight | 188.21 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | N-prop-2-enyl-1H-1,2,4-triazole-5-sulfonamide |
| SMILES | C=CCNS(=O)(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C5H8N4O2S/c1-2-3-8-12(10,11)5-6-4-7-9-5/h2,4,8H,1,3H2,(H,6,7,9) |
| InChIKey | ICZZYVBEUVFYMS-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.21 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-prop-2-enyl-1H-1,2,4-triazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-prop-2-enyl-1H-1,2,4-triazole-5-sulfonamide?
The IUPAC name of N-prop-2-enyl-1H-1,2,4-triazole-5-sulfonamide (CID 3884828) is N-prop-2-enyl-1H-1,2,4-triazole-5-sulfonamide.
What is the SMILES notation for N-prop-2-enyl-1H-1,2,4-triazole-5-sulfonamide?
The canonical SMILES for N-prop-2-enyl-1H-1,2,4-triazole-5-sulfonamide is C=CCNS(=O)(=O)c1ncn[nH]1.
What is the InChIKey of N-prop-2-enyl-1H-1,2,4-triazole-5-sulfonamide?
The InChIKey is ICZZYVBEUVFYMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4O2S/c1-2-3-8-12(10,11)5-6-4-7-9-5/h2,4,8H,1,3H2,(H,6,7,9).
What are the key properties of N-prop-2-enyl-1H-1,2,4-triazole-5-sulfonamide?
N-prop-2-enyl-1H-1,2,4-triazole-5-sulfonamide has a molecular weight of 188.21 g/mol, XLogP of -0.73, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-prop-2-enyl-1H-1,2,4-triazole-5-sulfonamide is sourced from PubChem (CID 3884828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).