C27H22N2O6 — CID 3885051
[2-ethoxy-4-[[1-(2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzoate (PubChem CID 3885051) has the molecular formula C27H22N2O6 and a molecular weight of 470.48 g/mol. Its IUPAC name is [2-ethoxy-4-[[1-(2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzoate.
| Compound Name | [2-ethoxy-4-[[1-(2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 3885051 |
| Molecular Formula | C27H22N2O6 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | [2-ethoxy-4-[[1-(2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzoate |
| SMILES | CCOc1cc(C=C2C(=O)NC(=O)N(c3ccccc3C)C2=O)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H22N2O6/c1-3-34-23-16-18(13-14-22(23)35-26(32)19-10-5-4-6-11-19)15-20-24(30)28-27(33)29(25(20)31)21-12-8-7-9-17(21)2/h4-16H,3H2,1-2H3,(H,28,30,33) |
| InChIKey | GLSRAGMCIIXRBS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|