About (7-bromo-2-oxochromen-4-yl)methyl 2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetate
(7-bromo-2-oxochromen-4-yl)methyl 2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetate (PubChem CID 38850535) has the molecular formula C18H15BrN2O5
and a molecular weight of 419.23 g/mol. Its IUPAC name is (7-bromo-2-oxochromen-4-yl)methyl 2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetate.
Molecular Properties
| Compound Name | (7-bromo-2-oxochromen-4-yl)methyl 2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetate |
| PubChem CID | 38850535 |
| Molecular Formula | C18H15BrN2O5 |
| Molecular Weight | 419.23 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | (7-bromo-2-oxochromen-4-yl)methyl 2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetate |
| SMILES | Cc1nn(C)c(C)c1C(=O)C(=O)OCc1cc(=O)oc2cc(Br)ccc12 |
| InChI | InChI=1S/C18H15BrN2O5/c1-9-16(10(2)21(3)20-9)17(23)18(24)25-8-11-6-15(22)26-14-7-12(19)4-5-13(11)14/h4-7H,8H2,1-3H3 |
| InChIKey | CMHYVJUFUNAUMY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 91.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (7-bromo-2-oxochromen-4-yl)methyl 2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-bromo-2-oxochromen-4-yl)methyl 2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetate?
The IUPAC name of (7-bromo-2-oxochromen-4-yl)methyl 2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetate (CID 38850535) is (7-bromo-2-oxochromen-4-yl)methyl 2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetate.
What is the SMILES notation for (7-bromo-2-oxochromen-4-yl)methyl 2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetate?
The canonical SMILES for (7-bromo-2-oxochromen-4-yl)methyl 2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetate is Cc1nn(C)c(C)c1C(=O)C(=O)OCc1cc(=O)oc2cc(Br)ccc12.
What is the InChIKey of (7-bromo-2-oxochromen-4-yl)methyl 2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetate?
The InChIKey is CMHYVJUFUNAUMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15BrN2O5/c1-9-16(10(2)21(3)20-9)17(23)18(24)25-8-11-6-15(22)26-14-7-12(19)4-5-13(11)14/h4-7H,8H2,1-3H3.
What are the key properties of (7-bromo-2-oxochromen-4-yl)methyl 2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetate?
(7-bromo-2-oxochromen-4-yl)methyl 2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetate has a molecular weight of 419.23 g/mol, XLogP of 2.83, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (7-bromo-2-oxochromen-4-yl)methyl 2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetate is sourced from PubChem (CID 38850535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).