About 2-(2,4-dichlorophenyl)-4-diphenylphosphoryl-5-piperidin-1-yl-1,3-oxazole
2-(2,4-dichlorophenyl)-4-diphenylphosphoryl-5-piperidin-1-yl-1,3-oxazole (PubChem CID 3885184) has the molecular formula C26H23Cl2N2O2P
and a molecular weight of 497.36 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-4-diphenylphosphoryl-5-piperidin-1-yl-1,3-oxazole.
Molecular Properties
| Compound Name | 2-(2,4-dichlorophenyl)-4-diphenylphosphoryl-5-piperidin-1-yl-1,3-oxazole |
| PubChem CID | 3885184 |
| Molecular Formula | C26H23Cl2N2O2P |
| Molecular Weight | 497.36 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-4-diphenylphosphoryl-5-piperidin-1-yl-1,3-oxazole |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1nc(-c2ccc(Cl)cc2Cl)oc1N1CCCCC1 |
| InChI | InChI=1S/C26H23Cl2N2O2P/c27-19-14-15-22(23(28)18-19)24-29-25(26(32-24)30-16-8-3-9-17-30)33(31,20-10-4-1-5-11-20)21-12-6-2-7-13-21/h1-2,4-7,10-15,18H,3,8-9,16-17H2 |
| InChIKey | KJDHYSWMHVWURA-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.36 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dichlorophenyl)-4-diphenylphosphoryl-5-piperidin-1-yl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dichlorophenyl)-4-diphenylphosphoryl-5-piperidin-1-yl-1,3-oxazole?
The IUPAC name of 2-(2,4-dichlorophenyl)-4-diphenylphosphoryl-5-piperidin-1-yl-1,3-oxazole (CID 3885184) is 2-(2,4-dichlorophenyl)-4-diphenylphosphoryl-5-piperidin-1-yl-1,3-oxazole.
What is the SMILES notation for 2-(2,4-dichlorophenyl)-4-diphenylphosphoryl-5-piperidin-1-yl-1,3-oxazole?
The canonical SMILES for 2-(2,4-dichlorophenyl)-4-diphenylphosphoryl-5-piperidin-1-yl-1,3-oxazole is O=P(c1ccccc1)(c1ccccc1)c1nc(-c2ccc(Cl)cc2Cl)oc1N1CCCCC1.
What is the InChIKey of 2-(2,4-dichlorophenyl)-4-diphenylphosphoryl-5-piperidin-1-yl-1,3-oxazole?
The InChIKey is KJDHYSWMHVWURA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23Cl2N2O2P/c27-19-14-15-22(23(28)18-19)24-29-25(26(32-24)30-16-8-3-9-17-30)33(31,20-10-4-1-5-11-20)21-12-6-2-7-13-21/h1-2,4-7,10-15,18H,3,8-9,16-17H2.
What are the key properties of 2-(2,4-dichlorophenyl)-4-diphenylphosphoryl-5-piperidin-1-yl-1,3-oxazole?
2-(2,4-dichlorophenyl)-4-diphenylphosphoryl-5-piperidin-1-yl-1,3-oxazole has a molecular weight of 497.36 g/mol, XLogP of 6.28, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dichlorophenyl)-4-diphenylphosphoryl-5-piperidin-1-yl-1,3-oxazole is sourced from PubChem (CID 3885184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).