About 6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione
6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione (PubChem CID 3885730) has the molecular formula C5H3N3S2
and a molecular weight of 169.23 g/mol. Its IUPAC name is 6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione.
Molecular Properties
| Compound Name | 6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione |
| PubChem CID | 3885730 |
| Molecular Formula | C5H3N3S2 |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 168.98 |
| IUPAC Name | 6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione |
| SMILES | S=c1[nH]cnc2scnc12 |
| InChI | InChI=1S/C5H3N3S2/c9-4-3-5(7-1-6-4)10-2-8-3/h1-2H,(H,6,7,9) |
| InChIKey | LKMUGGHJDVQIQC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione?
The IUPAC name of 6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione (CID 3885730) is 6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione.
What is the SMILES notation for 6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione?
The canonical SMILES for 6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione is S=c1[nH]cnc2scnc12.
What is the InChIKey of 6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione?
The InChIKey is LKMUGGHJDVQIQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3N3S2/c9-4-3-5(7-1-6-4)10-2-8-3/h1-2H,(H,6,7,9).
What are the key properties of 6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione?
6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione has a molecular weight of 169.23 g/mol, XLogP of 1.75, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione is sourced from PubChem (CID 3885730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).