C22H16ClN5OS — CID 38863077
1-[(6-chloro-3-pyridinyl)methylsulfanyl]-4-(4-methylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 38863077) has the molecular formula C22H16ClN5OS and a molecular weight of 433.92 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methylsulfanyl]-4-(4-methylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methylsulfanyl]-4-(4-methylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 38863077 |
| Molecular Formula | C22H16ClN5OS |
| Molecular Weight | 433.92 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methylsulfanyl]-4-(4-methylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | Cc1ccc(-n2c(=O)c3ccccc3n3c(SCc4ccc(Cl)nc4)nnc23)cc1 |
| InChI | InChI=1S/C22H16ClN5OS/c1-14-6-9-16(10-7-14)27-20(29)17-4-2-3-5-18(17)28-21(27)25-26-22(28)30-13-15-8-11-19(23)24-12-15/h2-12H,13H2,1H3 |
| InChIKey | UGFHUSSQWZRTRK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 65.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.92 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|