C24H23N3O4 — CID 38866732
1-cyclopentyl-3-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-2-oxoethyl]imidazolidine-2,4,5-trione (PubChem CID 38866732) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is 1-cyclopentyl-3-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-2-oxoethyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-cyclopentyl-3-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-2-oxoethyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 38866732 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 1-cyclopentyl-3-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-2-oxoethyl]imidazolidine-2,4,5-trione |
| SMILES | O=C1C(=O)N(C2CCCC2)C(=O)N1CC(=O)N1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C24H23N3O4/c28-21(15-25-22(29)23(30)26(24(25)31)18-9-3-4-10-18)27-19-11-5-1-7-16(19)13-14-17-8-2-6-12-20(17)27/h1-2,5-8,11-12,18H,3-4,9-10,13-15H2 |
| InChIKey | VIXIHIPJMAHBGP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|