C21H20FN3O5S — CID 3886677
[2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate (PubChem CID 3886677) has the molecular formula C21H20FN3O5S and a molecular weight of 445.47 g/mol. Its IUPAC name is [2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate.
| Compound Name | [2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 3886677 |
| Molecular Formula | C21H20FN3O5S |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | [2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate |
| SMILES | O=C(COC(=O)CN1C(=O)C2CCCCC2C1=O)Nc1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C21H20FN3O5S/c22-13-7-5-12(6-8-13)16-11-31-21(23-16)24-17(26)10-30-18(27)9-25-19(28)14-3-1-2-4-15(14)20(25)29/h5-8,11,14-15H,1-4,9-10H2,(H,23,24,26) |
| InChIKey | XVPLHOIAGCPOLT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|