C15H12BrClN6O2 — CID 3887230
N-[(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 3887230) has the molecular formula C15H12BrClN6O2 and a molecular weight of 423.66 g/mol. Its IUPAC name is N-[(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-[(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 3887230 |
| Molecular Formula | C15H12BrClN6O2 |
| Molecular Weight | 423.66 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | N-[(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1cc(C)n2nc(C(=O)NN=Cc3cc(Cl)cc(Br)c3O)nc2n1 |
| InChI | InChI=1S/C15H12BrClN6O2/c1-7-3-8(2)23-15(19-7)20-13(22-23)14(25)21-18-6-9-4-10(17)5-11(16)12(9)24/h3-6,24H,1-2H3,(H,21,25) |
| InChIKey | ROTQRCHNPOGUKY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 104.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.66 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|