About bis[2-(3-methylbutan-2-ylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate
bis[2-(3-methylbutan-2-ylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate (PubChem CID 3887546) has the molecular formula C21H31N3O6
and a molecular weight of 421.49 g/mol. Its IUPAC name is bis[2-(3-methylbutan-2-ylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate.
Molecular Properties
| Compound Name | bis[2-(3-methylbutan-2-ylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate |
| PubChem CID | 3887546 |
| Molecular Formula | C21H31N3O6 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | bis[2-(3-methylbutan-2-ylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate |
| SMILES | CC(C)C(C)NC(=O)COC(=O)c1cccc(C(=O)OCC(=O)NC(C)C(C)C)n1 |
| InChI | InChI=1S/C21H31N3O6/c1-12(2)14(5)22-18(25)10-29-20(27)16-8-7-9-17(24-16)21(28)30-11-19(26)23-15(6)13(3)4/h7-9,12-15H,10-11H2,1-6H3,(H,22,25)(H,23,26) |
| InChIKey | HIVPXFFEHOOKAE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze bis[2-(3-methylbutan-2-ylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-(3-methylbutan-2-ylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate?
The IUPAC name of bis[2-(3-methylbutan-2-ylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate (CID 3887546) is bis[2-(3-methylbutan-2-ylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate.
What is the SMILES notation for bis[2-(3-methylbutan-2-ylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate?
The canonical SMILES for bis[2-(3-methylbutan-2-ylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate is CC(C)C(C)NC(=O)COC(=O)c1cccc(C(=O)OCC(=O)NC(C)C(C)C)n1.
What is the InChIKey of bis[2-(3-methylbutan-2-ylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate?
The InChIKey is HIVPXFFEHOOKAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31N3O6/c1-12(2)14(5)22-18(25)10-29-20(27)16-8-7-9-17(24-16)21(28)30-11-19(26)23-15(6)13(3)4/h7-9,12-15H,10-11H2,1-6H3,(H,22,25)(H,23,26).
What are the key properties of bis[2-(3-methylbutan-2-ylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate?
bis[2-(3-methylbutan-2-ylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate has a molecular weight of 421.49 g/mol, XLogP of 1.72, 10 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-(3-methylbutan-2-ylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate is sourced from PubChem (CID 3887546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).