C26H19F6N5O3S — CID 3887894
N-[[5-[(2-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 3887894) has the molecular formula C26H19F6N5O3S and a molecular weight of 595.53 g/mol. Its IUPAC name is N-[[5-[(2-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[[5-[(2-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 3887894 |
| Molecular Formula | C26H19F6N5O3S |
| Molecular Weight | 595.53 g/mol |
| Exact Mass | 595.11 |
| IUPAC Name | N-[[5-[(2-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | Cc1ccccc1CSc1nnc(CNC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H19F6N5O3S/c1-15-4-2-3-5-16(15)14-41-24-35-34-22(36(24)20-6-8-21(9-7-20)37(39)40)13-33-23(38)17-10-18(25(27,28)29)12-19(11-17)26(30,31)32/h2-12H,13-14H2,1H3,(H,33,38) |
| InChIKey | CBMALWJKKVEMQD-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.53 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|