About N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(2-oxopyrrolidin-1-yl)benzamide
N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 38881249) has the molecular formula C17H19N3O3
and a molecular weight of 313.36 g/mol. Its IUPAC name is N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(2-oxopyrrolidin-1-yl)benzamide.
Molecular Properties
| Compound Name | N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(2-oxopyrrolidin-1-yl)benzamide |
| PubChem CID | 38881249 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | Cc1cc(CN(C)C(=O)c2cccc(N3CCCC3=O)c2)no1 |
| InChI | InChI=1S/C17H19N3O3/c1-12-9-14(18-23-12)11-19(2)17(22)13-5-3-6-15(10-13)20-8-4-7-16(20)21/h3,5-6,9-10H,4,7-8,11H2,1-2H3 |
| InChIKey | GRKWBNAOZSYWRF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(2-oxopyrrolidin-1-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(2-oxopyrrolidin-1-yl)benzamide?
The IUPAC name of N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(2-oxopyrrolidin-1-yl)benzamide (CID 38881249) is N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(2-oxopyrrolidin-1-yl)benzamide.
What is the SMILES notation for N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(2-oxopyrrolidin-1-yl)benzamide?
The canonical SMILES for N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(2-oxopyrrolidin-1-yl)benzamide is Cc1cc(CN(C)C(=O)c2cccc(N3CCCC3=O)c2)no1.
What is the InChIKey of N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(2-oxopyrrolidin-1-yl)benzamide?
The InChIKey is GRKWBNAOZSYWRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O3/c1-12-9-14(18-23-12)11-19(2)17(22)13-5-3-6-15(10-13)20-8-4-7-16(20)21/h3,5-6,9-10H,4,7-8,11H2,1-2H3.
What are the key properties of N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(2-oxopyrrolidin-1-yl)benzamide?
N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(2-oxopyrrolidin-1-yl)benzamide has a molecular weight of 313.36 g/mol, XLogP of 2.38, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(2-oxopyrrolidin-1-yl)benzamide is sourced from PubChem (CID 38881249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).