C21H20N2O4 — CID 38886699
methyl 4-[4-(5-phenyl-1,3-oxazol-2-yl)butanoylamino]benzoate (PubChem CID 38886699) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is methyl 4-[4-(5-phenyl-1,3-oxazol-2-yl)butanoylamino]benzoate.
| Compound Name | methyl 4-[4-(5-phenyl-1,3-oxazol-2-yl)butanoylamino]benzoate |
|---|---|
| PubChem CID | 38886699 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | methyl 4-[4-(5-phenyl-1,3-oxazol-2-yl)butanoylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CCCc2ncc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C21H20N2O4/c1-26-21(25)16-10-12-17(13-11-16)23-19(24)8-5-9-20-22-14-18(27-20)15-6-3-2-4-7-15/h2-4,6-7,10-14H,5,8-9H2,1H3,(H,23,24) |
| InChIKey | USARWIZDOAOXPT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |