C25H34N4O — CID 38886852
1-(1-benzylpiperidin-4-yl)-3-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]urea (PubChem CID 38886852) has the molecular formula C25H34N4O and a molecular weight of 406.57 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]urea.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 38886852 |
| Molecular Formula | C25H34N4O |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]urea |
| SMILES | O=C(NCc1cccc(CN2CCCC2)c1)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H34N4O/c30-25(26-18-22-9-6-10-23(17-22)20-28-13-4-5-14-28)27-24-11-15-29(16-12-24)19-21-7-2-1-3-8-21/h1-3,6-10,17,24H,4-5,11-16,18-20H2,(H2,26,27,30) |
| InChIKey | SWXAJJMZVNFCRQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |