About N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-1-ethyl-2-methylbenzimidazole-5-carboxamide
N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-1-ethyl-2-methylbenzimidazole-5-carboxamide (PubChem CID 3889458) has the molecular formula C21H22N4O
and a molecular weight of 346.43 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-1-ethyl-2-methylbenzimidazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-1-ethyl-2-methylbenzimidazole-5-carboxamide |
| PubChem CID | 3889458 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-1-ethyl-2-methylbenzimidazole-5-carboxamide |
| SMILES | CCn1c(C)nc2cc(C(=O)NN=C3CCCc4ccccc43)ccc21 |
| InChI | InChI=1S/C21H22N4O/c1-3-25-14(2)22-19-13-16(11-12-20(19)25)21(26)24-23-18-10-6-8-15-7-4-5-9-17(15)18/h4-5,7,9,11-13H,3,6,8,10H2,1-2H3,(H,24,26) |
| InChIKey | ZZYDJQBTWKSEPP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-1-ethyl-2-methylbenzimidazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-1-ethyl-2-methylbenzimidazole-5-carboxamide?
The IUPAC name of N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-1-ethyl-2-methylbenzimidazole-5-carboxamide (CID 3889458) is N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-1-ethyl-2-methylbenzimidazole-5-carboxamide.
What is the SMILES notation for N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-1-ethyl-2-methylbenzimidazole-5-carboxamide?
The canonical SMILES for N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-1-ethyl-2-methylbenzimidazole-5-carboxamide is CCn1c(C)nc2cc(C(=O)NN=C3CCCc4ccccc43)ccc21.
What is the InChIKey of N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-1-ethyl-2-methylbenzimidazole-5-carboxamide?
The InChIKey is ZZYDJQBTWKSEPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4O/c1-3-25-14(2)22-19-13-16(11-12-20(19)25)21(26)24-23-18-10-6-8-15-7-4-5-9-17(15)18/h4-5,7,9,11-13H,3,6,8,10H2,1-2H3,(H,24,26).
What are the key properties of N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-1-ethyl-2-methylbenzimidazole-5-carboxamide?
N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-1-ethyl-2-methylbenzimidazole-5-carboxamide has a molecular weight of 346.43 g/mol, XLogP of 3.84, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-1-ethyl-2-methylbenzimidazole-5-carboxamide is sourced from PubChem (CID 3889458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).