C21H14Cl3N5OS — CID 3889576
2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 3889576) has the molecular formula C21H14Cl3N5OS and a molecular weight of 490.80 g/mol. Its IUPAC name is 2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 3889576 |
| Molecular Formula | C21H14Cl3N5OS |
| Molecular Weight | 490.80 g/mol |
| Exact Mass | 489.00 |
| IUPAC Name | 2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | O=C(CSc1nnc(-c2ccncc2)n1-c1ccccc1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C21H14Cl3N5OS/c22-15-10-17(24)18(11-16(15)23)26-19(30)12-31-21-28-27-20(13-6-8-25-9-7-13)29(21)14-4-2-1-3-5-14/h1-11H,12H2,(H,26,30) |
| InChIKey | DWVOWTVSKYRXLX-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.80 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|