About 2,5-Diaminopentanoic Acid
2,5-Diaminopentanoic Acid (PubChem CID 389) has the molecular formula C5H12N2O2
and a molecular weight of 132.16 g/mol. Its IUPAC name is 2,5-diaminopentanoic acid.
Molecular Properties
| Compound Name | 2,5-Diaminopentanoic Acid |
| PubChem CID | 389 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 2,5-diaminopentanoic acid |
| SMILES | C(CC(C(=O)O)N)CN |
| InChI | InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9) |
| InChIKey | AHLPHDHHMVZTML-UHFFFAOYSA-N |
| XLogP | -4.40 |
| TPSA | 89.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | 95 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-Diaminopentanoic Acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-Diaminopentanoic Acid?
The IUPAC name of 2,5-Diaminopentanoic Acid (CID 389) is 2,5-diaminopentanoic acid.
What is the SMILES notation for 2,5-Diaminopentanoic Acid?
The canonical SMILES for 2,5-Diaminopentanoic Acid is C(CC(C(=O)O)N)CN.
What is the InChIKey of 2,5-Diaminopentanoic Acid?
The InChIKey is AHLPHDHHMVZTML-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9).
What are the key properties of 2,5-Diaminopentanoic Acid?
2,5-Diaminopentanoic Acid has a molecular weight of 132.16 g/mol, XLogP of -4.40, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-Diaminopentanoic Acid is sourced from PubChem (CID 389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).