About 1-[4-(2-amino-3-methylbutanoyl)-2-methylpiperazin-1-yl]-3,5,5-trimethylhexan-1-one
1-[4-(2-amino-3-methylbutanoyl)-2-methylpiperazin-1-yl]-3,5,5-trimethylhexan-1-one (PubChem CID 3890162) has the molecular formula C19H37N3O2
and a molecular weight of 339.52 g/mol. Its IUPAC name is 1-[4-(2-amino-3-methylbutanoyl)-2-methylpiperazin-1-yl]-3,5,5-trimethylhexan-1-one.
Molecular Properties
| Compound Name | 1-[4-(2-amino-3-methylbutanoyl)-2-methylpiperazin-1-yl]-3,5,5-trimethylhexan-1-one |
| PubChem CID | 3890162 |
| Molecular Formula | C19H37N3O2 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.29 |
| IUPAC Name | 1-[4-(2-amino-3-methylbutanoyl)-2-methylpiperazin-1-yl]-3,5,5-trimethylhexan-1-one |
| SMILES | CC(CC(=O)N1CCN(C(=O)C(N)C(C)C)CC1C)CC(C)(C)C |
| InChI | InChI=1S/C19H37N3O2/c1-13(2)17(20)18(24)21-8-9-22(15(4)12-21)16(23)10-14(3)11-19(5,6)7/h13-15,17H,8-12,20H2,1-7H3 |
| InChIKey | HZQRNMNPKLAHMS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-(2-amino-3-methylbutanoyl)-2-methylpiperazin-1-yl]-3,5,5-trimethylhexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2-amino-3-methylbutanoyl)-2-methylpiperazin-1-yl]-3,5,5-trimethylhexan-1-one?
The IUPAC name of 1-[4-(2-amino-3-methylbutanoyl)-2-methylpiperazin-1-yl]-3,5,5-trimethylhexan-1-one (CID 3890162) is 1-[4-(2-amino-3-methylbutanoyl)-2-methylpiperazin-1-yl]-3,5,5-trimethylhexan-1-one.
What is the SMILES notation for 1-[4-(2-amino-3-methylbutanoyl)-2-methylpiperazin-1-yl]-3,5,5-trimethylhexan-1-one?
The canonical SMILES for 1-[4-(2-amino-3-methylbutanoyl)-2-methylpiperazin-1-yl]-3,5,5-trimethylhexan-1-one is CC(CC(=O)N1CCN(C(=O)C(N)C(C)C)CC1C)CC(C)(C)C.
What is the InChIKey of 1-[4-(2-amino-3-methylbutanoyl)-2-methylpiperazin-1-yl]-3,5,5-trimethylhexan-1-one?
The InChIKey is HZQRNMNPKLAHMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H37N3O2/c1-13(2)17(20)18(24)21-8-9-22(15(4)12-21)16(23)10-14(3)11-19(5,6)7/h13-15,17H,8-12,20H2,1-7H3.
What are the key properties of 1-[4-(2-amino-3-methylbutanoyl)-2-methylpiperazin-1-yl]-3,5,5-trimethylhexan-1-one?
1-[4-(2-amino-3-methylbutanoyl)-2-methylpiperazin-1-yl]-3,5,5-trimethylhexan-1-one has a molecular weight of 339.52 g/mol, XLogP of 2.49, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2-amino-3-methylbutanoyl)-2-methylpiperazin-1-yl]-3,5,5-trimethylhexan-1-one is sourced from PubChem (CID 3890162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).