C27H24FN3O4 — CID 3890322
2-cyano-N-(2,3-dimethylphenyl)-3-[4-[2-(2-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]prop-2-enamide (PubChem CID 3890322) has the molecular formula C27H24FN3O4 and a molecular weight of 473.50 g/mol. Its IUPAC name is 2-cyano-N-(2,3-dimethylphenyl)-3-[4-[2-(2-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]prop-2-enamide.
| Compound Name | 2-cyano-N-(2,3-dimethylphenyl)-3-[4-[2-(2-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 3890322 |
| Molecular Formula | C27H24FN3O4 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 2-cyano-N-(2,3-dimethylphenyl)-3-[4-[2-(2-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cc(C=C(C#N)C(=O)Nc2cccc(C)c2C)ccc1OCC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C27H24FN3O4/c1-17-7-6-10-22(18(17)2)31-27(33)20(15-29)13-19-11-12-24(25(14-19)34-3)35-16-26(32)30-23-9-5-4-8-21(23)28/h4-14H,16H2,1-3H3,(H,30,32)(H,31,33) |
| InChIKey | HMQRUZVWGZHFMU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|