C12H20N4O3S — CID 3890342
6-[2-(2-ethoxyethoxy)ethyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrimido[4,5-d]pyrimidin-4-one (PubChem CID 3890342) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is 6-[2-(2-ethoxyethoxy)ethyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrimido[4,5-d]pyrimidin-4-one.
| Compound Name | 6-[2-(2-ethoxyethoxy)ethyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrimido[4,5-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3890342 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 6-[2-(2-ethoxyethoxy)ethyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrimido[4,5-d]pyrimidin-4-one |
| SMILES | CCOCCOCCN1CNc2[nH]c(=S)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C12H20N4O3S/c1-2-18-5-6-19-4-3-16-7-9-10(13-8-16)14-12(20)15-11(9)17/h2-8H2,1H3,(H3,13,14,15,17,20) |
| InChIKey | ZCGLAABVNSWFNX-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 82.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|