C13H13N3O3 — CID 3890361
(2-anilino-2-oxoethyl) 1-methylpyrazole-3-carboxylate (PubChem CID 3890361) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 1-methylpyrazole-3-carboxylate.
| Compound Name | (2-anilino-2-oxoethyl) 1-methylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 3890361 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | (2-anilino-2-oxoethyl) 1-methylpyrazole-3-carboxylate |
| SMILES | Cn1ccc(C(=O)OCC(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C13H13N3O3/c1-16-8-7-11(15-16)13(18)19-9-12(17)14-10-5-3-2-4-6-10/h2-8H,9H2,1H3,(H,14,17) |
| InChIKey | IZVJFGXNMCCLHO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |